Pseudoisocytidine hydrochloride structure
|
Common Name | Pseudoisocytidine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 59464-15-2 | Molecular Weight | 279.67800 | |
| Density | 1.98g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H14ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(1H)-Pyrimidinone, 2-amino-5-.β.-D-ribofuranosyl-, monohydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.98g/cm3 |
|---|---|
| Molecular Formula | C9H14ClN3O5 |
| Molecular Weight | 279.67800 |
| Exact Mass | 279.06200 |
| PSA | 141.69000 |
| Index of Refraction | 1.788 |
| InChIKey | JEIABKUXHKINSZ-MDTBIHKOSA-N |
| SMILES | Cl.Nc1ncc(C2OC(CO)C(O)C2O)c(=O)[nH]1 |
|
~92%
Pseudoisocytidi... CAS#:59464-15-2 |
| Literature: Sato; Hayakawa; Noyori Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 9 p. 2515 - 2525 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| pseudoisocytidine hydrochloride |
| 3',4'-methylenedioxy-7-hydroxyisoflavone |
| pseudobaptisin aglycone |
| 90-29-9 |
| |x-Baptigenin |
| 7-hydroxy-3',4'-methylenedioxyisoflavone |
| Pseudobaptigenin |