3-(2-hydroxy-2,2-diphenyl-ethyl)benzonitrile structure
|
Common Name | 3-(2-hydroxy-2,2-diphenyl-ethyl)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 59483-74-8 | Molecular Weight | 299.36600 | |
| Density | 1.19g/cm3 | Boiling Point | 453ºC at 760 mmHg | |
| Molecular Formula | C21H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 3-(2-hydroxy-2,2-diphenylethyl)benzonitrile |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 453ºC at 760 mmHg |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.36600 |
| Flash Point | 227.7ºC |
| Exact Mass | 299.13100 |
| PSA | 44.02000 |
| LogP | 4.03688 |
| Index of Refraction | 1.652 |
| InChIKey | VEXIHHXFKNPFSC-UHFFFAOYSA-N |
| SMILES | N#Cc1cccc(CC(O)(c2ccccc2)c2ccccc2)c1 |
|
~%
3-(2-hydroxy-2,... CAS#:59483-74-8 |
| Literature: Kaiser,E.N.; Petty,J.D. Journal of Organometallic Chemistry, 1976 , vol. 107, p. 219 - 228 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |