ethyl (E)-3-(1,4-dioxonaphthalen-2-yl)sulfanylbut-2-enoate structure
|
Common Name | ethyl (E)-3-(1,4-dioxonaphthalen-2-yl)sulfanylbut-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 59484-01-4 | Molecular Weight | 302.34500 | |
| Density | 1.3g/cm3 | Boiling Point | 441.7ºC at 760 mmHg | |
| Molecular Formula | C16H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | ethyl (E)-3-(1,4-dioxonaphthalen-2-yl)sulfanylbut-2-enoate |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 441.7ºC at 760 mmHg |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.34500 |
| Flash Point | 217.6ºC |
| Exact Mass | 302.06100 |
| PSA | 85.74000 |
| LogP | 3.14960 |
| Index of Refraction | 1.609 |
| InChIKey | IZGDZQDQPKJZKG-CSKARUKUSA-N |
| SMILES | CCOC(=O)C=C(C)SC1=CC(=O)c2ccccc2C1=O |
|
~%
ethyl (E)-3-(1,... CAS#:59484-01-4 |
| Literature: Campaigne,E.; Abe,Y. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 559 - 562 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |