1,3-Hexanedione,4,4,5,5,6,6,6-heptafluoro-1-(2-furanyl)- structure
|
Common Name | 1,3-Hexanedione,4,4,5,5,6,6,6-heptafluoro-1-(2-furanyl)- | ||
|---|---|---|---|---|
| CAS Number | 595-26-6 | Molecular Weight | 306.13400 | |
| Density | 1.491g/cm3 | Boiling Point | 240.6ºC at 760mmHg | |
| Molecular Formula | C10H5F7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 99.3ºC | |
| Name | 4,4,5,5,6,6,6-heptafluoro-1-(furan-2-yl)hexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 240.6ºC at 760mmHg |
| Molecular Formula | C10H5F7O3 |
| Molecular Weight | 306.13400 |
| Flash Point | 99.3ºC |
| Exact Mass | 306.01300 |
| PSA | 47.28000 |
| LogP | 3.25440 |
| Index of Refraction | 1.385 |
| InChIKey | ATAOWIQUJGHXOL-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccco1 |
|
~%
1,3-Hexanedione... CAS#:595-26-6 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H,2H-heptafluoro-1-[2]furyl-hexane-1,3-dione |
| 4,4,5,5,6,6,6-heptafluoro-1-(2-furyl)-1,3-hexanedione |
| 2H,2H-Heptafluor-1-[2]furyl-hexan-1,3-dion |
| 4,4,5,5,6,6-Heptafluor-1-{furyl-(2)}-hexandion-(1,3) |
| 1,3-Hexanedione,4,4,5,5,6,6,6-heptafluoro-1-(2-furyl) |