Bornyl dibromodihydrocinnamate structure
|
Common Name | Bornyl dibromodihydrocinnamate | ||
|---|---|---|---|---|
| CAS Number | 595-81-3 | Molecular Weight | 444.20100 | |
| Density | 1.48g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C19H24Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.3ºC | |
| Name | (4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl) 2,3-dibromo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Molecular Formula | C19H24Br2O2 |
| Molecular Weight | 444.20100 |
| Flash Point | 208.3ºC |
| Exact Mass | 442.01400 |
| PSA | 26.30000 |
| LogP | 5.64410 |
| Index of Refraction | 1.585 |
| InChIKey | BRONBTPPHUNMRC-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC1(C)C(OC(=O)C(Br)C(Br)c1ccccc1)C2 |
|
~%
Bornyl dibromod... CAS#:595-81-3 |
| Literature: Bayer and Co. Patent: DE252158 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 945 |
|
~%
Bornyl dibromod... CAS#:595-81-3 |
| Literature: Bayer and Co. Patent: DE252158 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 945 |
| 2,3-dibromo-3-phenyl-propionic acid bornyl ester |
| 2,3-Dibrom-3-phenyl-propionsaeure-isobornylester |
| 2,3-Dibrom-3-phenyl-propionsaeure-bornylester |