ethyl 2-chloro-4,5-dinitro-benzoate structure
|
Common Name | ethyl 2-chloro-4,5-dinitro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 59504-26-6 | Molecular Weight | 274.61500 | |
| Density | 1.53g/cm3 | Boiling Point | 432ºC at 760 mmHg | |
| Molecular Formula | C9H7ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.1ºC | |
| Name | ethyl 2-chloro-4,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 432ºC at 760 mmHg |
| Molecular Formula | C9H7ClN2O6 |
| Molecular Weight | 274.61500 |
| Flash Point | 215.1ºC |
| Exact Mass | 273.99900 |
| PSA | 117.94000 |
| LogP | 3.37950 |
| Index of Refraction | 1.59 |
| InChIKey | LQHUEYNWNIKRKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])c([N+](=O)[O-])cc1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ETHYL 2-CHLORO-4,5-DINITRO-BENZOATE |
| 2-Chlor-4,5-dinitro-benzoesaeure-ethylester |