6-bromo-9-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-one structure
|
Common Name | 6-bromo-9-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-one | ||
|---|---|---|---|---|
| CAS Number | 59514-19-1 | Molecular Weight | 278.14400 | |
| Density | 1.57g/cm3 | Boiling Point | 433.4ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | 6-bromo-9-methyl-2,3,4,9-tetrahydro-1H-carbazol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 433.4ºC at 760 mmHg |
| Molecular Formula | C13H12BrNO |
| Molecular Weight | 278.14400 |
| Flash Point | 215.9ºC |
| Exact Mass | 277.01000 |
| PSA | 22.00000 |
| LogP | 3.45980 |
| Index of Refraction | 1.685 |
| InChIKey | SKCOAJQVJZTOEY-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c3cc(Br)ccc31)CCCC2=O |
| HS Code | 2933990090 |
|---|
|
~34%
6-bromo-9-methy... CAS#:59514-19-1 |
| Literature: PTC THERAPEUTICS, INC. Patent: WO2006/58088 A2, 2006 ; Location in patent: Page/Page column 54; 55 ; |
|
~%
6-bromo-9-methy... CAS#:59514-19-1 |
| Literature: Sergeev; Artamkina; Velezheva; Fedorova; Beletskaya Russian Journal of Organic Chemistry, 2005 , vol. 41, # 6 p. 860 - 874 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-bromo-9-methyl-1,2,3,4-tetrahydrocarbazol-1-one |
| 6-bromo-9-methyl-2,3,4,9-tetrahydro-carbazol-1-one |