N,N-Diethylglycine (p-phenylphenacylidene)hydrazide structure
|
Common Name | N,N-Diethylglycine (p-phenylphenacylidene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 5956-92-3 | Molecular Weight | 337.41600 | |
| Density | 1.08g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(diethylamino)-N-[(E)-[2-oxo-2-(4-phenylphenyl)ethylidene]amino]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.41600 |
| Exact Mass | 337.17900 |
| PSA | 65.26000 |
| LogP | 3.82040 |
| Index of Refraction | 1.564 |
| InChIKey | TVFRIKZMHKOXMS-KGENOOAVSA-N |
| SMILES | CCN(CC)CC(=O)NN=CC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
N,N-Diethylglyc... CAS#:5956-92-3 |
| Literature: Massarani; Nardi; Degen; Magistretti Journal of medicinal chemistry, 1966 , vol. 9, # 4 p. 617 - 618 |
| N,N-Diethylglycine (p-phenylphenacylidene)hydrazide |
| GLYCINE,N,N-DIETHYL-,(p-PHENYLPHENACYLIDENE)HYDRAZIDE |