5'-S-1H-imidazol-2-yl-5'-thio-Adenosine
Modify Date: 2026-04-28 17:02:48
5'-S-1H-imidazol-2-yl-5'-thio-Adenosine structure
|
Common Name | 5'-S-1H-imidazol-2-yl-5'-thio-Adenosine | ||
|---|---|---|---|---|
| CAS Number | 595608-60-9 | Molecular Weight | 349.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N7O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5'-S-1H-imidazol-2-yl-5'-thio-Adenosine |
|---|
| Molecular Formula | C13H15N7O3S |
|---|---|
| Molecular Weight | 349.37 |
| InChIKey | RAVZCFVYBJGXAY-WOUKDFQISA-N |
| SMILES | C1=CN=C(N1)SC[C@@H]2[C@H]([C@H]([C@@H](O2)N3C=NC4=C(N=CN=C43)N)O)O |
|
Name: Kcat against human methylthioadenosine phosphorylase expressed in Escherichia coli BL...
Source: ChEMBL
Target: S-methyl-5'-thioadenosine phosphorylase
External Id: CHEMBL828699
|
|
Name: Km against human methylthioadenosine phosphorylase expressed in Escherichia coli BL21...
Source: ChEMBL
Target: S-methyl-5'-thioadenosine phosphorylase
External Id: CHEMBL827246
|
|
Name: Ratio of Kcat to Km against human Methylthioadenosine phosphorylase
Source: ChEMBL
Target: S-methyl-5'-thioadenosine phosphorylase
External Id: CHEMBL829265
|
Total 3, Current Page 1 of 1
1