3,3-Bis-(2-furanyl)-acrylic acid ethyl ester
Modify Date: 2025-09-29 19:02:38
3,3-Bis-(2-furanyl)-acrylic acid ethyl ester structure
|
Common Name | 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 59562-39-9 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12O4 |
|---|---|
| Molecular Weight | 232.23 |
| InChIKey | GYHUXBRMANBVHE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(c1ccco1)c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: Molecular weight of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is 232.23. |
| Q: What is the Chinese name of 59562-39-9? |
| A: Chinese name of 59562-39-9 is 59562-39-9. |
| Q: What is the InChIKey of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: InChIKey of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is GYHUXBRMANBVHE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: CAS number of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is 59562-39-9. |
| Q: What is the SMILES notation of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: SMILES notation of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is CCOC(=O)C=C(c1ccco1)c1ccco1. |
| Q: What is the molecular formula of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: Molecular formula of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is C13H12O4. |
| Q: What is the English name of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester? |
| A: The English name of 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester is 3,3-Bis-(2-furanyl)-acrylic acid ethyl ester. |