2-aminobenzoate,cadmium(2+) structure
|
Common Name | 2-aminobenzoate,cadmium(2+) | ||
|---|---|---|---|---|
| CAS Number | 5959-14-8 | Molecular Weight | 384.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12CdN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-aminobenzoate,cadmium(2+) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12CdN2O4 |
|---|---|
| Molecular Weight | 384.66700 |
| Exact Mass | 385.98300 |
| PSA | 132.30000 |
| LogP | 0.42450 |
| InChIKey | GTQCDNXFFYZDED-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1C(=O)O.Nc1ccccc1C(=O)O.[Cd] |
| HS Code | 2922499990 |
|---|
|
~%
2-aminobenzoate... CAS#:5959-14-8 |
| Literature: Hoppe, Horst-Ruediger; Andrae, Klaus Zeitschrift fuer Chemie (Stuttgart, Germany), 1986 , vol. 26, p. 75 - 76 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Cadmium dianthranilate |
| o-Aminobenzoic acid cadmium salt |