2-(1,3-dioxoisoindol-2-yl)-3-(3H-imidazol-4-yl)propanoic acid structure
|
Common Name | 2-(1,3-dioxoisoindol-2-yl)-3-(3H-imidazol-4-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5959-79-5 | Molecular Weight | 285.25500 | |
| Density | 1.571g/cm3 | Boiling Point | 607.2ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321ºC | |
| Name | 2-(1,3-dioxoisoindol-2-yl)-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 607.2ºC at 760 mmHg |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.25500 |
| Flash Point | 321ºC |
| Exact Mass | 285.07500 |
| PSA | 103.36000 |
| LogP | 0.63950 |
| Index of Refraction | 1.698 |
| InChIKey | CTUUVOUXZNQMSU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1cnc[nH]1)N1C(=O)c2ccccc2C1=O |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1,3-dioxo-1,3-dihydro-isoindol-2-yl)-3-(3h-imidazol-4-yl)-propionic acid |
| 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-(1H-imidazol-4-yl)propanoic acid |
| 2-phthalimido-3-(imidazol-4-yl)propionic acid |