2,7-dichloro-6-hydroxy-9-phenyl-3H-xanthen-3-one
2,7-dichloro-6-hydroxy-9-phenyl-3H-xanthen-3-one structure
|
Common Name | 2,7-dichloro-6-hydroxy-9-phenyl-3H-xanthen-3-one | ||
|---|---|---|---|---|
| CAS Number | 596-12-3 | Molecular Weight | 357.18700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H10Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H10Cl2O3 |
|---|---|
| Molecular Weight | 357.18700 |
| Exact Mass | 356.00100 |
| PSA | 50.44000 |
| LogP | 5.57720 |
| InChIKey | WRBIJMLVKQAREM-UHFFFAOYSA-N |
| SMILES | O=c1cc2oc3cc(O)c(Cl)cc3c(-c3ccccc3)c-2cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,7-dichloro-6-... CAS#:596-12-3 |
| Literature: Le Royer Justus Liebigs Annalen der Chemie, 1887 , vol. 238, p. 357 |
|
~%
2,7-dichloro-6-... CAS#:596-12-3 |
| Literature: Le Royer Justus Liebigs Annalen der Chemie, 1887 , vol. 238, p. 357 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,7-DICHLORO-6-HYDROXY-9-PHENYL-3H-XANTHEN-3-ONE |
| 4,7-Dichlor-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-on |
| 4,7-dichloro-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-one |
| 4,7-dichloro-fluorescein |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: The English name of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one. |
| Q: What is the LogP of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: LogP of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is 5.57720. |
| Q: What is the SMILES notation of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: SMILES notation of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is O=c1cc2oc3cc(O)c(Cl)cc3c(-c3ccccc3)c-2cc1Cl. |
| Q: What are the upstream materials of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: Related upstream materials(CAS) of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one: 4466-59-5;108-46-3;16110-99-9. |
| Q: What is the CAS number of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: CAS number of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is 596-12-3. |
| Q: What is the polar surface area (PSA) of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: Polar surface area (PSA) of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is 50.44000. |
| Q: What is the molecular weight of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: Molecular weight of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is 357.18700. |
| Q: What English synonyms does 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one have? |
| A: English synonyms of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one: 2,7-DICHLORO-6-HYDROXY-9-PHENYL-3H-XANTHEN-3-ONE, 4,7-Dichlor-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-on, 4,7-dichloro-3',6'-dihydroxy-spiro[phthalan-1,9'-xanthen]-3-one, 4,7-dichloro-fluorescein. |
| Q: What is the Chinese name of 596-12-3? |
| A: Chinese name of 596-12-3 is 596-12-3. |
| Q: What is the InChIKey of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one? |
| A: InChIKey of 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one is WRBIJMLVKQAREM-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |