ethyl methyl 2-ethyl-2-phenyl-propanedioate structure
|
Common Name | ethyl methyl 2-ethyl-2-phenyl-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 596-33-8 | Molecular Weight | 250.29000 | |
| Density | 1.092g/cm3 | Boiling Point | 315.8ºC at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5ºC | |
| Name | 1-O-ethyl 3-O-methyl 2-ethyl-2-phenylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 315.8ºC at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 148.5ºC |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.07050 |
| Index of Refraction | 1.494 |
| InChIKey | RDMAXRCDPQFFQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(C(=O)OC)c1ccccc1 |
| HS Code | 2917399090 |
|---|
|
~%
ethyl methyl 2-... CAS#:596-33-8 |
| Literature: Eastman Kodak Co. Patent: US1966317 , 1932 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Aethyl-phenyl-malonsaeure-aethylester-methylester |
| ethyl-phenyl-malonic acid ethyl ester-methyl ester |
| Aethyl-phenyl-malonsaeuremethylesteraethylester |
| ethyl methyl ethyl(phenyl)propanedioate |