(5Z)-1-(4-Methoxyphenyl)-5-{[3-(2-phenoxyethoxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione
Modify Date: 2026-04-19 11:17:02
![(5Z)-1-(4-Methoxyphenyl)-5-{[3-(2-phenoxyethoxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione Structure](https://www.chemsrc.com/extcaspic/095/5960-20-3.png)
(5Z)-1-(4-Methoxyphenyl)-5-{[3-(2-phenoxyethoxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione structure
|
Common Name | (5Z)-1-(4-Methoxyphenyl)-5-{[3-(2-phenoxyethoxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 5960-20-3 | Molecular Weight | 458.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-1-(4-Methoxyphenyl)-5-{[3-(2-phenoxyethoxy)phenyl]methylidene}-1,3-diazinane-2,4,6-trione |
|---|
| Molecular Formula | C26H22N2O6 |
|---|---|
| Molecular Weight | 458.5 |
| InChIKey | PHOCRPHWIKBTNO-QJOMJCCJSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)/C(=C\C3=CC(=CC=C3)OCCOC4=CC=CC=C4)/C(=O)NC2=O |
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
Total 2, Current Page 1 of 1
1