Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl
Modify Date: 2026-09-06 19:43:51
Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl structure
|
Common Name | Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl | ||
|---|---|---|---|---|
| CAS Number | 59639-97-3 | Molecular Weight | 204.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H8N2O4S |
|---|---|
| Molecular Weight | 204.21 |
| InChIKey | XHPAFNWWJRKRIQ-UHFFFAOYSA-N |
| SMILES | C=CCN(C(=O)N=C=O)S(C)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: InChIKey of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is XHPAFNWWJRKRIQ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: Molecular weight of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is 204.21. |
| Q: What is the SMILES notation of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: SMILES notation of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is C=CCN(C(=O)N=C=O)S(C)(=O)=O. |
| Q: What is the Chinese name of 59639-97-3? |
| A: Chinese name of 59639-97-3 is 59639-97-3. |
| Q: What is the English name of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: The English name of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl. |
| Q: What is the CAS number of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: CAS number of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is 59639-97-3. |
| Q: What is the molecular formula of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl? |
| A: Molecular formula of Methanesulfonamide, N-(isocyanatocarbonyl)-N-2-propenyl is C6H8N2O4S. |