hexyl 2-(dichloroamino)-2-methylpropanoate structure
|
Common Name | hexyl 2-(dichloroamino)-2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 59661-02-8 | Molecular Weight | 256.16900 | |
| Density | 1.127g/cm3 | Boiling Point | 297ºC at 760 mmHg | |
| Molecular Formula | C10H19Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.4ºC | |
| Name | hexyl 2-(dichloroamino)-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 297ºC at 760 mmHg |
| Molecular Formula | C10H19Cl2NO2 |
| Molecular Weight | 256.16900 |
| Flash Point | 133.4ºC |
| Exact Mass | 255.07900 |
| PSA | 29.54000 |
| LogP | 3.49810 |
| Index of Refraction | 1.471 |
| InChIKey | ZEWMIHUUOWVKMK-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)C(C)(C)N(Cl)Cl |
| HS Code | 2922499990 |
|---|
|
~%
hexyl 2-(dichlo... CAS#:59661-02-8 |
| Literature: Kaminski; Bodor; Higuchi Journal of Pharmaceutical Sciences, 1976 , vol. 65, # 4 p. 553 - 557 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Alanine,N,N-dichloro-2-methyl-,hexyl ester |
| HEXYL 2-(DICHLOROAMINO)-2-METHYL-PROPANOATE |