1'-oxobufuralol
1'-oxobufuralol structure
|
Common Name | 1'-oxobufuralol | ||
|---|---|---|---|---|
| CAS Number | 59664-01-6 | Molecular Weight | 275.34300 | |
| Density | 1.129g/cm3 | Boiling Point | 427.3ºC at 760 mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 427.3ºC at 760 mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 212.2ºC |
| Exact Mass | 275.15200 |
| PSA | 62.47000 |
| LogP | 3.44780 |
| Index of Refraction | 1.566 |
| InChIKey | UJFKLSLVTSFAQN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cccc2cc(C(O)CNC(C)(C)C)oc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1''-oxobufuralol |
| 2-Tbhbmk |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: The English name of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone. |
| Q: What is the InChIKey of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: InChIKey of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is UJFKLSLVTSFAQN-UHFFFAOYSA-N. |
| Q: What English synonyms does 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone have? |
| A: English synonyms of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone: 1''-oxobufuralol, 2-Tbhbmk. |
| Q: What is the LogP of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: LogP of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is 3.44780. |
| Q: What is the Chinese name of 59664-01-6? |
| A: Chinese name of 59664-01-6 is 59664-01-6. |
| Q: What is the molecular weight of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: Molecular weight of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is 275.34300. |
| Q: What is the polar surface area (PSA) of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: Polar surface area (PSA) of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is 62.47000. |
| Q: What is the molecular formula of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: Molecular formula of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is C16H21NO3. |
| Q: What is the SMILES notation of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: SMILES notation of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is CC(=O)c1cccc2cc(C(O)CNC(C)(C)C)oc12. |
| Q: What is the CAS number of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone? |
| A: CAS number of 1-[2-[2-(tert-butylamino)-1-hydroxyethyl]-1-benzofuran-7-yl]ethanone is 59664-01-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |