3-O-Acetyl-beta-boswellic acid structure
|
Common Name | 3-O-Acetyl-beta-boswellic acid | ||
|---|---|---|---|---|
| CAS Number | 5968-70-7 | Molecular Weight | 498.737 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 566.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H50O4 | Melting Point | 157-161ºC | |
| MSDS | USA | Flash Point | 171.4±23.6 °C | |
Use of 3-O-Acetyl-beta-boswellic acid3-Acetyl-beta-boswellic acid is a boswellic acid isolated from Boswellia serrata gum resin[1]. |
| Name | (3R,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-3-acetyloxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Acetyl-beta-boswellic acid is a boswellic acid isolated from Boswellia serrata gum resin[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 566.8±50.0 °C at 760 mmHg |
| Melting Point | 157-161ºC |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.737 |
| Flash Point | 171.4±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 10.27 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | YJBVHJIKNLBFDX-MQURJEHKSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4C(C)C(C)CCC4(C)CCC23C)C1(C)C(=O)O |
| RIDADR | NONH for all modes of transport |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| (3α)-3-Acetoxyurs-12-en-24-oic acid |
| Urs-12-en-24-oic acid, 3-(acetyloxy)-, (3α)- |
| Boswellia serrata hexane extract in Methanol |
| (3α)-3-(acetyloxy)urs-12-en-24-oic acid |
| 3|A-Hydroxyurs-12-en-24-oic acid acetate |
| UNII-5M3483EOU5 |
| β-Boswellic acid acetate |