Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester
Modify Date: 2026-07-02 09:02:17
Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester structure
|
Common Name | Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 596809-64-2 | Molecular Weight | 260.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClFO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14ClFO3 |
|---|---|
| Molecular Weight | 260.69 |
| InChIKey | KLQFSISCPDUHCY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OCCCCl)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: Molecular formula of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is C12H14ClFO3. |
| Q: What is the Chinese name of 596809-64-2? |
| A: Chinese name of 596809-64-2 is 596809-64-2. |
| Q: What is the InChIKey of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: InChIKey of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is KLQFSISCPDUHCY-UHFFFAOYSA-N. |
| Q: What is the English name of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: The English name of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester. |
| Q: What is the CAS number of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: CAS number of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is 596809-64-2. |
| Q: What is the molecular weight of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: Molecular weight of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is 260.69. |
| Q: What is the SMILES notation of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester? |
| A: SMILES notation of Benzoic acid,4-(3-chloropropoxy)-3-fluoro-,ethyl ester is CCOC(=O)c1ccc(OCCCCl)c(F)c1. |