Biotin-PEG2-NHS ester
Modify Date: 2025-08-25 16:33:58
Biotin-PEG2-NHS ester structure
|
Common Name | Biotin-PEG2-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 596820-83-6 | Molecular Weight | 500.56578 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H32N4O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG2-NHS esterBiotin-PEG2-NHS ester is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 9-biotinlaMino-4,7-dioxanonanoic acid N-hydroxysucciniMidyl ester |
|---|
| Description | Biotin-PEG2-NHS ester is a biotin-labeled, PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C21H32N4O8S |
|---|---|
| Molecular Weight | 500.56578 |
| InChIKey | UCJSJBIJPAZUGU-AVYPCKFXSA-N |
| SMILES | O=C(CCCCC1SCC2NC(=O)NC21)NCCOCCOCCC(=O)ON1C(=O)CCC1=O |