5,6-Dichloro-2,3-pyrazinedicarboxylic acid structure
|
Common Name | 5,6-Dichloro-2,3-pyrazinedicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 59715-45-6 | Molecular Weight | 236.997 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 453.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.8±28.7 °C | |
| Name | 5,6-Dichloropyrazine-2,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 453.0±45.0 °C at 760 mmHg |
| Molecular Formula | C6H2Cl2N2O4 |
| Molecular Weight | 236.997 |
| Flash Point | 227.8±28.7 °C |
| Exact Mass | 235.939163 |
| PSA | 100.38000 |
| LogP | -0.34 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | WPBFEEVLBDWFGP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1nc(Cl)c(Cl)nc1C(=O)O |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrazin-2,3-dichlor-5,6-dicarbonsaeure |
| 5,6-Dichloro-2,3-pyrazinedicarboxylic acid |
| 5,6-dichloro-pyrazine-2,3-dicarboxylic acid |
| 2,3-Pyrazinedicarboxylic acid, 5,6-dichloro- |