3-Chloro-2-nitrobenzamide structure
|
Common Name | 3-Chloro-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 59772-47-3 | Molecular Weight | 200.579 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 304.7±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H5ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.1±23.7 °C | |
| Name | 3-chloro-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.7±27.0 °C at 760 mmHg |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.579 |
| Flash Point | 138.1±23.7 °C |
| Exact Mass | 199.998871 |
| PSA | 88.91000 |
| LogP | 0.73 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | MCRCSTFZVNYBHR-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc(Cl)c1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~99%
3-Chloro-2-nitr... CAS#:59772-47-3 |
| Literature: Shimojo, Masato; Taniguchi, Kana Patent: US2003/236260 A1, 2003 ; Location in patent: Page 116 ; US 20030236260 A1 |
|
~95%
3-Chloro-2-nitr... CAS#:59772-47-3 |
| Literature: Guengoer, Timur; Fouquet, Andre; Teulon, Jean-Marie; Provost, Daniel; Cazes, Michele; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 23 p. 4455 - 4463 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chloro-2-nitrobenzamid |
| 3-Chloro-2-nitrobenzamide |
| 2-nitro-3-chlorobenzamide |