1-(2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 59817-22-0 | Molecular Weight | 314.33300 | |
| Density | 1.207g/cm3 | Boiling Point | 491.6ºC at 760 mmHg | |
| Molecular Formula | C18H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.3ºC | |
| Name | 1-(2-hydroxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 491.6ºC at 760 mmHg |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33300 |
| Flash Point | 177.3ºC |
| Exact Mass | 314.11500 |
| PSA | 64.99000 |
| LogP | 3.31410 |
| Index of Refraction | 1.599 |
| InChIKey | SRSBUHVXNLHWHU-CMDGGOBGSA-N |
| SMILES | COc1cc(C=CC(=O)c2ccccc2O)cc(OC)c1OC |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Flavokawain A |
| E-3-(4-methoxyphenyl)-1-(2,4-bismethoxy-6-hydroxyphenyl)propenone |
| 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one |
| 3,4,5-trimethoxy-2'-hydroxychalcone |
| hydroxy-2' trimethoxy-3,4,5 chalcone |
| crotaoprostrin |
| 2'-hydroxy-4,4',6'-trimethoxy-chalcone |
| 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)propenone |
| (2E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one |
| 2'-hydroxy-4',6'-dimethoxyphenyl-4-methoxystyrylketone |
| (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| FlavokavinA |
| 2'-hydroxy-3,4,5-trimethoxychalcone |