4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol
4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol structure
|
Common Name | 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 59830-39-6 | Molecular Weight | 256.31800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O4S |
|---|---|
| Molecular Weight | 256.31800 |
| Exact Mass | 256.07700 |
| PSA | 71.98000 |
| LogP | 2.48830 |
| InChIKey | MDCWYYUCLPWJRF-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)CC(C)=CCO)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-(4-methoxyphe... CAS#:59830-39-6 |
| Literature: Olson; Cheung; Morgan; Neukom; Saucy Journal of Organic Chemistry, 1976 , vol. 41, # 20 p. 3287 - 3293 |
|
~%
4-(4-methoxyphe... CAS#:59830-39-6 |
| Literature: Olson; Cheung; Morgan; Neukom; Saucy Journal of Organic Chemistry, 1976 , vol. 41, # 20 p. 3287 - 3293 |
|
~%
4-(4-methoxyphe... CAS#:59830-39-6 |
| Literature: Olson; Cheung; Morgan; Neukom; Saucy Journal of Organic Chemistry, 1976 , vol. 41, # 20 p. 3287 - 3293 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Buten-1-ol,4-[(4-methoxyphenyl)sulfonyl]-3-methyl-,(E) |
| 1-(p-methoxyphenylsulfonyl)-2-methyl-4-hydroxy-but-2-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: CAS number of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is 59830-39-6. |
| Q: What is the molecular weight of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: Molecular weight of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is 256.31800. |
| Q: What is the molecular formula of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: Molecular formula of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is C12H16O4S. |
| Q: What is the SMILES notation of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: SMILES notation of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is COc1ccc(S(=O)(=O)CC(C)=CCO)cc1. |
| Q: What is the InChIKey of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: InChIKey of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is MDCWYYUCLPWJRF-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: The English name of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol. |
| Q: What is the Chinese name of 59830-39-6? |
| A: Chinese name of 59830-39-6 is 59830-39-6. |
| Q: What English synonyms does 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol have? |
| A: English synonyms of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol: 2-Buten-1-ol,4-[(4-methoxyphenyl)sulfonyl]-3-methyl-,(E), 1-(p-methoxyphenylsulfonyl)-2-methyl-4-hydroxy-but-2-ene. |
| Q: What is the LogP of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: LogP of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is 2.48830. |
| Q: What is the polar surface area (PSA) of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol? |
| A: Polar surface area (PSA) of 4-(4-methoxyphenyl)sulfonyl-3-methylbut-2-en-1-ol is 71.98000. |