6-diphenylphosphanylhexanoic acid
6-diphenylphosphanylhexanoic acid structure
|
Common Name | 6-diphenylphosphanylhexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 59847-19-7 | Molecular Weight | 300.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-diphenylphosphanylhexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21O2P |
|---|---|
| Molecular Weight | 300.33200 |
| Exact Mass | 300.12800 |
| PSA | 50.89000 |
| LogP | 3.76430 |
| InChIKey | DCNCQTXEEAAZBS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCP(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-diphenylphosp... CAS#:59847-19-7 |
| Literature: Horner,L.; Schumacher,F. Justus Liebigs Annalen der Chemie, 1976 , p. 633 - 640 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hexanoic acid,6-(diphenylphosphino) |
| 6-Diphenylphosphinohexansaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-diphenylphosphanylhexanoic acid? |
| A: CAS number of 6-diphenylphosphanylhexanoic acid is 59847-19-7. |
| Q: What is the English name of 6-diphenylphosphanylhexanoic acid? |
| A: The English name of 6-diphenylphosphanylhexanoic acid is 6-diphenylphosphanylhexanoic acid. |
| Q: What is the polar surface area (PSA) of 6-diphenylphosphanylhexanoic acid? |
| A: Polar surface area (PSA) of 6-diphenylphosphanylhexanoic acid is 50.89000. |
| Q: What is the SMILES notation of 6-diphenylphosphanylhexanoic acid? |
| A: SMILES notation of 6-diphenylphosphanylhexanoic acid is O=C(O)CCCCCP(c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of 6-diphenylphosphanylhexanoic acid? |
| A: Molecular formula of 6-diphenylphosphanylhexanoic acid is C18H21O2P. |
| Q: What is the molecular weight of 6-diphenylphosphanylhexanoic acid? |
| A: Molecular weight of 6-diphenylphosphanylhexanoic acid is 300.33200. |
| Q: What is the LogP of 6-diphenylphosphanylhexanoic acid? |
| A: LogP of 6-diphenylphosphanylhexanoic acid is 3.76430. |
| Q: What is the Chinese name of 59847-19-7? |
| A: Chinese name of 59847-19-7 is 59847-19-7. |
| Q: What English synonyms does 6-diphenylphosphanylhexanoic acid have? |
| A: English synonyms of 6-diphenylphosphanylhexanoic acid: Hexanoic acid,6-(diphenylphosphino), 6-Diphenylphosphinohexansaeure. |
| Q: What is the InChIKey of 6-diphenylphosphanylhexanoic acid? |
| A: InChIKey of 6-diphenylphosphanylhexanoic acid is DCNCQTXEEAAZBS-UHFFFAOYSA-N. |