NPD9948 structure
|
Common Name | NPD9948 | ||
|---|---|---|---|---|
| CAS Number | 59856-85-8 | Molecular Weight | 254.290 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 679.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C13H14N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.9±34.3 °C | |
Use of NPD9948NPD9948 is a competitive MTH1 inhibitor. |
| Name | N6-(2-Phenylethyl)-7H-purine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 679.8±65.0 °C at 760 mmHg |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.290 |
| Flash Point | 364.9±34.3 °C |
| Exact Mass | 254.127991 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.781 |
| InChIKey | VVAAYEZVIGGGED-UHFFFAOYSA-N |
| SMILES | Nc1nc(NCCc2ccccc2)c2[nH]cnc2n1 |
| N6-(2-Phenylethyl)-7H-purine-2,6-diamine |
| 7H-Purine-2,6-diamine, N6-(2-phenylethyl)- |