palustrol structure
|
Common Name | palustrol | ||
|---|---|---|---|---|
| CAS Number | 5986-49-2 | Molecular Weight | 222.37 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 293.7±8.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.0±10.9 °C | |
Use of palustrolPalustrol is a natural sesquiterpenoid compound[1]. |
| Name | (-)(1aR)-4at-Hydroxy-1.1.4ξ.7t-tetramethyl-(1arH.7atH.7bcH)-decahydro-1H-cycloprop[e]azulen |
|---|---|
| Synonym | More Synonyms |
| Description | Palustrol is a natural sesquiterpenoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.7±8.0 °C at 760 mmHg |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| Flash Point | 123.0±10.9 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 4.74 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | QWRTXOOFEHOROQ-UHFFFAOYSA-N |
| SMILES | CC1CCC2(O)C(C)CCC3C(C12)C3(C)C |
| 1,1,4,7-Tetramethyldecahydro-4aH-cyclopropa[e]azulen-4a-ol |
| palustrol (ledum) |