Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one
Modify Date: 2026-07-15 10:49:29
Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one structure
|
Common Name | Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 5986-56-1 | Molecular Weight | 220.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24O |
|---|---|
| Molecular Weight | 220.35 |
| InChIKey | ZXXHMUIBFQZQDH-UHFFFAOYSA-N |
| SMILES | CC1CCC23C(C)C(=O)CC(CC12)C3(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: The English name of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one. |
| Q: What is the Chinese name of 5986-56-1? |
| A: Chinese name of 5986-56-1 is 5986-56-1. |
| Q: What is the InChIKey of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: InChIKey of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is ZXXHMUIBFQZQDH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: Molecular weight of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is 220.35. |
| Q: What is the molecular formula of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: Molecular formula of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is C15H24O. |
| Q: What is the CAS number of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: CAS number of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is 5986-56-1. |
| Q: What is the SMILES notation of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one? |
| A: SMILES notation of Hexahydro-1,4,9,9-tetramethyl-1H-3a,7-methanoazulen-5(4H)-one is CC1CCC23C(C)C(=O)CC(CC12)C3(C)C. |