4-(3-phenylpropanoyloxy)but-2-enyl benzoate structure
|
Common Name | 4-(3-phenylpropanoyloxy)but-2-enyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 59863-57-9 | Molecular Weight | 324.37000 | |
| Density | 1.141g/cm3 | Boiling Point | 458.9ºC at 760 mmHg | |
| Molecular Formula | C20H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.3ºC | |
| Name | [(E)-4-(3-phenylpropanoyloxy)but-2-enyl] benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.141g/cm3 |
|---|---|
| Boiling Point | 458.9ºC at 760 mmHg |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.37000 |
| Flash Point | 228.3ºC |
| Exact Mass | 324.13600 |
| PSA | 52.60000 |
| LogP | 3.57560 |
| Index of Refraction | 1.561 |
| InChIKey | UTAQTHGOLHFTKG-BQYQJAHWSA-N |
| SMILES | O=C(CCc1ccccc1)OCC=CCOC(=O)c1ccccc1 |
|
~%
4-(3-phenylprop... CAS#:59863-57-9 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4024164 A1, 1977 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Benzoyloxy-2-butenyl hydrocinnamate |