2-imino-9-phenyl-7-thia-1,3,5,10-tetrazabicyclo[4.4.0]deca-3,5,8-trien-4-amine structure
|
Common Name | 2-imino-9-phenyl-7-thia-1,3,5,10-tetrazabicyclo[4.4.0]deca-3,5,8-trien-4-amine | ||
|---|---|---|---|---|
| CAS Number | 59894-16-5 | Molecular Weight | 258.30200 | |
| Density | 1.64g/cm3 | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C11H10N6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | 4-imino-7-phenyl-6H-[1,3,5]triazino[2,1-b][1,3,4]thiadiazin-2-amine |
|---|
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 427.6ºC at 760 mmHg |
| Molecular Formula | C11H10N6S |
| Molecular Weight | 258.30200 |
| Flash Point | 212.4ºC |
| Exact Mass | 258.06900 |
| PSA | 124.09000 |
| LogP | 2.09070 |
| Index of Refraction | 1.852 |
| InChIKey | UPKGXINKIJUCHS-UHFFFAOYSA-N |
| SMILES | N=c1nc(N)nc2n1NC(c1ccccc1)=CS2 |
|
~%
2-imino-9-pheny... CAS#:59894-16-5 |
| Literature: Joshua,C.P.; Rajan,V.P. Australian Journal of Chemistry, 1976 , vol. 29, p. 1051 - 1058 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |