Medicagenic acid structure
|
Common Name | Medicagenic acid | ||
|---|---|---|---|---|
| CAS Number | 599-07-5 | Molecular Weight | 502.68300 | |
| Density | 1.23g/cm3 | Boiling Point | 635.9ºC at 760 mmHg | |
| Molecular Formula | C30H46O6 | Melting Point | 380-382ºC (dec.) | |
| MSDS | N/A | Flash Point | 352.4ºC | |
Use of Medicagenic acidMedicagenic acid (Castanogenin) is isolated from the roots of Herniaria glabra L, exhibits potent fungistatic effects against several plant pathogens and human dermatophytes[1]. Medicagenic acid (Castanogenin) has low enzyme inhibitory activities, the target enzymes are xanthine oxidase, collagenase, elastase, tyrosinase, ChE[2]. |
| Name | (2S,3R,4S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-2,3-dihydroxy-4,6a,6b,11,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-4,8a-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Medicagenic acid (Castanogenin) is isolated from the roots of Herniaria glabra L, exhibits potent fungistatic effects against several plant pathogens and human dermatophytes[1]. Medicagenic acid (Castanogenin) has low enzyme inhibitory activities, the target enzymes are xanthine oxidase, collagenase, elastase, tyrosinase, ChE[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 635.9ºC at 760 mmHg |
| Melting Point | 380-382ºC (dec.) |
| Molecular Formula | C30H46O6 |
| Molecular Weight | 502.68300 |
| Flash Point | 352.4ºC |
| Exact Mass | 502.32900 |
| PSA | 115.06000 |
| LogP | 5.26910 |
| Index of Refraction | 1.587 |
| InChIKey | IDGXIXSKISLYAC-WNTKNEGGSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C(=O)O)C5CCC43C)C2C1 |
| Medicagenic acid |
| medicagensaeure |
| Castanogenin |