o-Tolyl p-toluenesulfonate structure
|
Common Name | o-Tolyl p-toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 599-75-7 | Molecular Weight | 262.32400 | |
| Density | 1.216g/cm3 | Boiling Point | 400.8ºC at 760 mmHg | |
| Molecular Formula | C14H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2ºC | |
| Name | (2-methylphenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 400.8ºC at 760 mmHg |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.32400 |
| Flash Point | 196.2ºC |
| Exact Mass | 262.06600 |
| PSA | 51.75000 |
| LogP | 4.15190 |
| Index of Refraction | 1.575 |
| InChIKey | WBKWVLAHWVFXKM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2C)cc1 |
|
~98%
o-Tolyl p-tolue... CAS#:599-75-7 |
| Literature: Fazaeli, Razieh; Tangestaninejad, Shahram; Aliyan, Hamid Canadian Journal of Chemistry, 2006 , vol. 84, # 5 p. 812 - 818 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| o-Tolyl p-toluenesulfonate |
| 2-MeC6H4OTs |
| o-tolyl 4-methylbenzenesulfonate |
| 2-tolyl tosylate |
| 2-methylphenyl p-toluenesulfonate |
| 2-methylphenyl 4-methylbenzenesulfonate |
| 2-methylphenyltosylate |