1-chloro-2-methyl-4-(4-methylphenyl)sulfonyloxy-benzene structure
|
Common Name | 1-chloro-2-methyl-4-(4-methylphenyl)sulfonyloxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 599-85-9 | Molecular Weight | 296.76900 | |
| Density | 1.303g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C14H13ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | 4-chloro-3-methylphenyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Molecular Formula | C14H13ClO3S |
| Molecular Weight | 296.76900 |
| Flash Point | 215.3ºC |
| Exact Mass | 296.02700 |
| PSA | 51.75000 |
| LogP | 4.80530 |
| Index of Refraction | 1.583 |
| InChIKey | CGPJEKIQZSYWLP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Cl)c(C)c2)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Toluol-4-sulfonsaeure-(4-chlor-3-methyl-phenylester) |
| Toluol-4-sulfonsaeure-(4-amino-N-methyl-anilid) |
| toluene-4-sulfonic acid-(4-chloro-3-methyl-phenyl ester) |
| (p-Chlor-m-kresyl)-p-tolyl-sulfonat |
| 5-Amino-N-methyl-p-toluenesulfonanilide |
| N-p-Toluolsulfonyl-N-methyl-p-phenylendiamin |
| toluene-4-sulfonic acid-(4-amino-N-methyl-anilide) |