4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate
Modify Date: 2025-09-01 18:28:57
4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate structure
|
Common Name | 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate | ||
|---|---|---|---|---|
| CAS Number | 59921-81-2 | Molecular Weight | 351.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H22FNO5 |
|---|---|
| Molecular Weight | 351.4 |
| InChIKey | BYJRTACTJXNRJN-BTJKTKAUSA-N |
| SMILES | O=C(CCC(F)N1CCCC1)c1ccccc1.O=C(O)C=CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 59921-81-2? |
| A: Chinese name of 59921-81-2 is 59921-81-2. |
| Q: What is the InChIKey of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: InChIKey of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is BYJRTACTJXNRJN-BTJKTKAUSA-N. |
| Q: What is the SMILES notation of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: SMILES notation of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is O=C(CCC(F)N1CCCC1)c1ccccc1.O=C(O)C=CC(=O)O. |
| Q: What is the molecular formula of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: Molecular formula of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is C18H22FNO5. |
| Q: What is the molecular weight of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: Molecular weight of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is 351.4. |
| Q: What is the CAS number of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: CAS number of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is 59921-81-2. |
| Q: What is the English name of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate? |
| A: The English name of 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate is 4-Fluoro-1-phenyl-4-(pyrrolidin-1-yl)butan-1-one maleate. |