Phosphorodichloridicacid, 4-chloro-2-(dichlorophenylmethyl)phenyl ester (9CI) structure
|
Common Name | Phosphorodichloridicacid, 4-chloro-2-(dichlorophenylmethyl)phenyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5995-76-6 | Molecular Weight | 404.44000 | |
| Density | 1.562g/cm3 | Boiling Point | 453.5ºC at 760mmHg | |
| Molecular Formula | C13H8Cl5O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 372.7ºC | |
| Name | 4-chloro-2-[dichloro(phenyl)methyl]-1-dichlorophosphoryloxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.562g/cm3 |
|---|---|
| Boiling Point | 453.5ºC at 760mmHg |
| Molecular Formula | C13H8Cl5O2P |
| Molecular Weight | 404.44000 |
| Flash Point | 372.7ºC |
| Exact Mass | 401.87000 |
| PSA | 36.11000 |
| LogP | 6.98320 |
| Index of Refraction | 1.598 |
| InChIKey | ZPIKXBUGFVUWNV-UHFFFAOYSA-N |
| SMILES | O=P(Cl)(Cl)Oc1ccc(Cl)cc1C(Cl)(Cl)c1ccccc1 |
|
~99%
Phosphorodichlo... CAS#:5995-76-6 |
| Literature: Pinkus; Ma; Meng; Chang Organic Preparations and Procedures International, 2004 , vol. 36, # 2 p. 192 - 194 |
|
~%
Phosphorodichlo... CAS#:5995-76-6 |
| Literature: Pinkus; Chang, Tsung C.; Meng, Lily Y. C. Organic Preparations and Procedures International, 2004 , vol. 36, # 6 p. 600 - 604 |
| 4-chloro-2-[dichloro(phenyl)methyl]phenyl phosphorodichloridate |