Dimethyl 1,5-dibromo-2,6-naphthalenedicarboxylate structure
|
Common Name | Dimethyl 1,5-dibromo-2,6-naphthalenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 59950-04-8 | Molecular Weight | 402.035 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 447.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H10Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1±27.3 °C | |
| Name | dimethyl 1,5-dibromonaphthalene-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.0±40.0 °C at 760 mmHg |
| Molecular Formula | C14H10Br2O4 |
| Molecular Weight | 402.035 |
| Flash Point | 224.1±27.3 °C |
| Exact Mass | 399.894562 |
| PSA | 52.60000 |
| LogP | 4.17 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | AYNJKLGLVWJRJK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(Br)c(C(=O)OC)ccc2c1Br |
| HS Code | 2917399090 |
|---|
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,6-Naphthalenedicarboxylic acid, 1,5-dibromo-, dimethyl ester |
| 1,5-dibromo-2,6-naphthalenedicarboxylic acid dimethyl ester |
| Dimethyl 1,5-dibromo-2,6-naphthalenedicarboxylate |
| Dimethyl 1,5-dibromonaphthalene-2,6-dicarboxylate |