2-Phenyl-1,2-dihydroisothiochromeno(4,3-c)pyrazol-3(5H)-one structure
|
Common Name | 2-Phenyl-1,2-dihydroisothiochromeno(4,3-c)pyrazol-3(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 59961-27-2 | Molecular Weight | 280.34400 | |
| Density | 1.42g/cm3 | Boiling Point | 471.5ºC at 760 mmHg | |
| Molecular Formula | C16H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.9ºC | |
| Name | 2-phenyl-1,5-dihydroisothiochromeno[4,3-c]pyrazol-3-one |
|---|
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 471.5ºC at 760 mmHg |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.34400 |
| Flash Point | 238.9ºC |
| Exact Mass | 280.06700 |
| PSA | 63.09000 |
| LogP | 3.43830 |
| Index of Refraction | 1.764 |
| InChIKey | ZSQFBFDZTRDPQI-UHFFFAOYSA-N |
| SMILES | O=c1c2c([nH]n1-c1ccccc1)-c1ccccc1CS2 |
|
~%
2-Phenyl-1,2-di... CAS#:59961-27-2 |
| Literature: Scrowston,R.M.; Shaw,D.C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 749 - 754 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |