[4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone
Modify Date: 2026-07-14 19:43:21
![[4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone Structure](https://www.chemsrc.com/extcaspic/478/5997-40-0.png)
[4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone structure
|
Common Name | [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone | ||
|---|---|---|---|---|
| CAS Number | 5997-40-0 | Molecular Weight | 202.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2O8 |
|---|---|
| Molecular Weight | 202.07 |
| InChIKey | CKNSWIPHRGJNCK-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C(C2OC(=O)OC2=O)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: CAS number of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is 5997-40-0. |
| Q: What is the SMILES notation of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: SMILES notation of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is O=C1OC(=O)C(C2OC(=O)OC2=O)O1. |
| Q: What is the InChIKey of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: InChIKey of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is CKNSWIPHRGJNCK-UHFFFAOYSA-N. |
| Q: What is the English name of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: The English name of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone. |
| Q: What is the Chinese name of 5997-40-0? |
| A: Chinese name of 5997-40-0 is 5997-40-0. |
| Q: What is the molecular weight of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: Molecular weight of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is 202.07. |
| Q: What is the molecular formula of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone? |
| A: Molecular formula of [4,4a(2)-Bi-1,3-dioxolane]-2,2a(2),5,5a(2)-tetrone is C6H2O8. |