(3,5-dimethyl-1,2-oxazol-4-yl)-(4-nitrophenyl)diazene structure
|
Common Name | (3,5-dimethyl-1,2-oxazol-4-yl)-(4-nitrophenyl)diazene | ||
|---|---|---|---|---|
| CAS Number | 59972-38-2 | Molecular Weight | 246.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,5-dimethyl-1,2-oxazol-4-yl)-(4-nitrophenyl)diazene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10N4O3 |
|---|---|
| Molecular Weight | 246.22200 |
| Exact Mass | 246.07500 |
| PSA | 96.57000 |
| LogP | 4.13820 |
| InChIKey | SNRCXNZQKHKBSH-UHFFFAOYSA-N |
| SMILES | Cc1noc(C)c1N=Nc1ccc([N+](=O)[O-])cc1 |
|
~%
(3,5-dimethyl-1... CAS#:59972-38-2 |
| Literature: Garg,H.G. Journal of the Indian Chemical Society, 1963 , vol. 40, p. 135 - 136 |
|
~%
(3,5-dimethyl-1... CAS#:59972-38-2 |
| Literature: Wrubel,J. et al. Journal fuer Praktische Chemie (Leipzig), 1976 , vol. 318, p. 359 - 368 |
| Isoxazole,3,5-dimethyl-4-[(4-nitrophenyl)azo] |
| (3,5-dimethylisoxazol-4-yl)(4-nitrophenyl)diazene |
| 4-(4-Nitrophenylazo)-3,5-dimethylisoxazol |
| 3,5-dimethyl-4-(4-nitro-phenylazo)-isoxazole |