(2-bromo-1-fluoro-1-phenylpropyl)benzene
Modify Date: 2024-09-10 18:08:23
(2-bromo-1-fluoro-1-phenylpropyl)benzene structure
|
Common Name | (2-bromo-1-fluoro-1-phenylpropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 59974-23-1 | Molecular Weight | 293.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14BrF | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-bromo-1-fluoro-1-phenylpropyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14BrF |
|---|---|
| Molecular Weight | 293.17400 |
| Exact Mass | 292.02600 |
| LogP | 4.68310 |
| InChIKey | UCBWGZBDABYVAB-UHFFFAOYSA-N |
| SMILES | CC(Br)C(F)(c1ccccc1)c1ccccc1 |
|
~%
(2-bromo-1-fluo... CAS#:59974-23-1 |
| Literature: Zupan,M.; Pollak,A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 971 - 975 |
| 1,1-Diphenyl-1-fluor-2-brompropan |
| Benzene,1,1'-(2-bromo-1-fluoropropylidene)bis |
| 1,1-Diphenyl-1-fluor-2-brom-2-methylethan |