Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride
Modify Date: 2026-08-01 22:26:17
Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride structure
|
Common Name | Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 59984-85-9 | Molecular Weight | 230.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15ClN2O2 |
|---|---|
| Molecular Weight | 230.69 |
| InChIKey | UWGFMVGJPPWRSW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(CNN)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: Molecular weight of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is 230.69. |
| Q: What is the Chinese name of 59984-85-9? |
| A: Chinese name of 59984-85-9 is 59984-85-9. |
| Q: What is the CAS number of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: CAS number of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is 59984-85-9. |
| Q: What is the InChIKey of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: InChIKey of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is UWGFMVGJPPWRSW-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: The English name of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride. |
| Q: What is the SMILES notation of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: SMILES notation of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is CCOC(=O)c1ccc(CNN)cc1.Cl. |
| Q: What is the molecular formula of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride? |
| A: Molecular formula of Ethyl 4-(hydrazinylmethyl)benzoate hydrochloride is C10H15ClN2O2. |