N-[3,5-bis(1,1-dimethylethyl)-2-hydroxyphenyl]acetamide structure
|
Common Name | N-[3,5-bis(1,1-dimethylethyl)-2-hydroxyphenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 60043-08-5 | Molecular Weight | 263.37500 | |
| Density | 1.035g/cm3 | Boiling Point | 366.5ºC at 760 mmHg | |
| Molecular Formula | C16H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.5ºC | |
| Name | N-(3,5-ditert-butyl-2-hydroxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 366.5ºC at 760 mmHg |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.37500 |
| Flash Point | 175.5ºC |
| Exact Mass | 263.18900 |
| PSA | 52.82000 |
| LogP | 4.59510 |
| Index of Refraction | 1.535 |
| InChIKey | CHAOLRKYRZZMKR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| HS Code | 2924299090 |
|---|
|
~96%
N-[3,5-bis(1,1-... CAS#:60043-08-5 |
| Literature: Shadyro; Sorokin; Ksendzova; Nikolaeva; Pavlova; Savinova; Boreko Pharmaceutical Chemistry Journal, 2002 , vol. 36, # 8 p. 410 - 412 |
|
~46%
N-[3,5-bis(1,1-... CAS#:60043-08-5 |
| Literature: Fukata, Gouki; Sakamoto, Naoya; Tashiro, Masashi Heterocycles, 1980 , vol. 14, # 9 p. 1259 - 1264 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3,5-di-tert-butyl-2-hydroxyphenyl)acetamide |
| 4,6-di-(tert-butyl)-2-(N-acetylamino)phenol |
| EINECS 262-033-9 |
| N-[3,5-BIS(1,1-DIMETHYLETHYL)-2-HYDROXYPHENYL]ACETAMIDE |
| 2-Acetylamino-4,6-di-tert-butylphenol |