2-(3,4-dibromo-5-methyl-pyrazol-1-yl)-N,N-dimethyl-butanamide structure
|
Common Name | 2-(3,4-dibromo-5-methyl-pyrazol-1-yl)-N,N-dimethyl-butanamide | ||
|---|---|---|---|---|
| CAS Number | 60060-75-5 | Molecular Weight | 353.05400 | |
| Density | 1.67g/cm3 | Boiling Point | 404.6ºC at 760 mmHg | |
| Molecular Formula | C10H15Br2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.5ºC | |
| Name | 2-(3,4-dibromo-5-methylpyrazol-1-yl)-N,N-dimethylbutanamide |
|---|
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 404.6ºC at 760 mmHg |
| Molecular Formula | C10H15Br2N3O |
| Molecular Weight | 353.05400 |
| Flash Point | 198.5ºC |
| Exact Mass | 350.95800 |
| PSA | 38.13000 |
| LogP | 2.75580 |
| Index of Refraction | 1.603 |
| InChIKey | DYXZQYKGGUNMDN-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)N(C)C)n1nc(Br)c(Br)c1C |
|
~%
2-(3,4-dibromo-... CAS#:60060-75-5 |
| Literature: The Upjohn Company Patent: US3957480 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |