6,6,6-Trichloro-3,3-dimethyl-4-hexenoic acid ethyl ester structure
|
Common Name | 6,6,6-Trichloro-3,3-dimethyl-4-hexenoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 60066-83-3 | Molecular Weight | 273.58400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 6,6,6-trichloro-3,3-dimethylhex-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15Cl3O2 |
|---|---|
| Molecular Weight | 273.58400 |
| Exact Mass | 272.01400 |
| PSA | 26.30000 |
| LogP | 3.89220 |
| InChIKey | YMXLOSPLQMWDAI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C)C=CC(Cl)(Cl)Cl |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 3,3-Dimethyl-6,6,6-trichlor-4-hexensaeure-ethylester |
| 4-Hexenoic acid,6,6,6-trichloro-3,3-dimethyl-,ethyl ester,(E) |
| ethyl 6,6,6-trichoro-3,3-dimethyl-4-hexenoate |
| 6,6,6-Trichloro-3,3-dimethyl-4-hexenoic acid ethyl ester |
| 4-Hexenoic acid,6,6,6-trichloro-3,3-dimethyl-,ethyl ester |
| 6,6,6-Trichlor-3,3-dimethyl-4-hexensaeure-ethylester |