p-Iodophenyloctyl=carbonate structure
|
Common Name | p-Iodophenyloctyl=carbonate | ||
|---|---|---|---|---|
| CAS Number | 60075-63-0 | Molecular Weight | 376.23000 | |
| Density | 1.388g/cm3 | Boiling Point | 396.8ºC at 760 mmHg | |
| Molecular Formula | C15H21IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | (4-iodophenyl) octyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 396.8ºC at 760 mmHg |
| Molecular Formula | C15H21IO3 |
| Molecular Weight | 376.23000 |
| Flash Point | 193.8ºC |
| Exact Mass | 376.05400 |
| PSA | 35.53000 |
| LogP | 5.16710 |
| Index of Refraction | 1.537 |
| InChIKey | DVOSSBAPRMJVJD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)Oc1ccc(I)cc1 |
| HS Code | 2920909090 |
|---|
|
~%
p-Iodophenyloct... CAS#:60075-63-0 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| n-Octyl-p-iodophenyl carbonate |
| CARBONIC ACID,p-IODOPHENYL OCTYL ESTER |
| 4-iodophenyl octyl carbonate |