Carbonic acid 1-ethylbutyl p-iodobenzyl ester structure
|
Common Name | Carbonic acid 1-ethylbutyl p-iodobenzyl ester | ||
|---|---|---|---|---|
| CAS Number | 60075-69-6 | Molecular Weight | 362.20300 | |
| Density | 1.428g/cm3 | Boiling Point | 366.4ºC at 760 mmHg | |
| Molecular Formula | C14H19IO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 3-Hexanyl 4-iodobenzyl carbonate |
|---|
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 366.4ºC at 760 mmHg |
| Molecular Formula | C14H19IO3 |
| Molecular Weight | 362.20300 |
| Flash Point | 175.4ºC |
| Exact Mass | 362.03800 |
| PSA | 35.53000 |
| LogP | 4.52310 |
| Index of Refraction | 1.543 |
| InChIKey | VZYPHFGDCPTQEA-UHFFFAOYSA-N |
| SMILES | CCCC(CC)OC(=O)OCc1ccc(I)cc1 |
|
~%
Carbonic acid 1... CAS#:60075-69-6 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
|
~%
Carbonic acid 1... CAS#:60075-69-6 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |