Carbonic acid 2-ethoxycarbonyl-1-methylethyl 4-iodobenzyl ester structure
|
Common Name | Carbonic acid 2-ethoxycarbonyl-1-methylethyl 4-iodobenzyl ester | ||
|---|---|---|---|---|
| CAS Number | 60075-74-3 | Molecular Weight | 392.18600 | |
| Density | 1.525g/cm3 | Boiling Point | 409.8ºC at 760 mmHg | |
| Molecular Formula | C14H17IO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | Ethyl 3-({[(4-iodobenzyl)oxy]carbonyl}oxy)butanoate |
|---|
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 409.8ºC at 760 mmHg |
| Molecular Formula | C14H17IO5 |
| Molecular Weight | 392.18600 |
| Flash Point | 201.7ºC |
| Exact Mass | 392.01200 |
| PSA | 61.83000 |
| LogP | 3.28610 |
| Index of Refraction | 1.548 |
| InChIKey | URGSDWBERIYKIF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)OC(=O)OCc1ccc(I)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
Carbonic acid 2... CAS#:60075-74-3 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
|
~%
Carbonic acid 2... CAS#:60075-74-3 |
| Literature: Newton,B.N. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 1362 - 1366 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |