2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane
2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane structure
|
Common Name | 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane | ||
|---|---|---|---|---|
| CAS Number | 6008-75-9 | Molecular Weight | 292.84700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13ClS2 |
|---|---|
| Molecular Weight | 292.84700 |
| Exact Mass | 292.01500 |
| PSA | 50.60000 |
| LogP | 5.02110 |
| InChIKey | GZBJCSGYSATLSZ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2(c3ccccc3)SCCS2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
2-(4-chlorophen... CAS#:6008-75-9 |
| Literature: Shaterian, Hamid Reza; Azizi, Kobra; Fahimi, Nafiseh Journal of Sulfur Chemistry, 2011 , vol. 32, # 1 p. 85 - 91 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-Dithiolane,2-(4-chlorophenyl)-2-phenyl |
| 2-(4-chloro-phenyl)-2-phenyl-[1,3]dithiolane |
| 2-(4-Chlor-phenyl)-2-phenyl-[1,3]dithiolan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: Molecular formula of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is C15H13ClS2. |
| Q: What is the English name of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: The English name of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane. |
| Q: What is the SMILES notation of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: SMILES notation of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is Clc1ccc(C2(c3ccccc3)SCCS2)cc1. |
| Q: What is the molecular weight of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: Molecular weight of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is 292.84700. |
| Q: What is the Chinese name of 6008-75-9? |
| A: Chinese name of 6008-75-9 is 6008-75-9. |
| Q: What is the InChIKey of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: InChIKey of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is GZBJCSGYSATLSZ-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: LogP of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is 5.02110. |
| Q: What is the CAS number of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: CAS number of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is 6008-75-9. |
| Q: What is the polar surface area (PSA) of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane? |
| A: Polar surface area (PSA) of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane is 50.60000. |
| Q: What English synonyms does 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane have? |
| A: English synonyms of 2-(4-chlorophenyl)-2-phenyl-1,3-dithiolane: 1,3-Dithiolane,2-(4-chlorophenyl)-2-phenyl, 2-(4-chloro-phenyl)-2-phenyl-[1,3]dithiolane, 2-(4-Chlor-phenyl)-2-phenyl-[1,3]dithiolan. |