1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene
1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene structure
|
Common Name | 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 60082-87-3 | Molecular Weight | 356.45900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl5O |
|---|---|
| Molecular Weight | 356.45900 |
| Exact Mass | 353.89400 |
| PSA | 9.23000 |
| LogP | 6.62920 |
| InChIKey | ZBZQCPOTSOEMGU-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2ccc(Cl)c(Cl)c2Cl)cc(Cl)c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Detail
Learn More
|
| Literature: Bergman, A.; Klasson Wehler, E.; Kuroki, H.; Nilsson, A. Chemosphere, 1995 , vol. 30, # 10 p. 1921 - 1938 |
|
~%
1,2,3-trichloro... CAS#:60082-87-3 |
| Literature: Jansson; Sundstroem Biomedical mass spectrometry, 1974 , vol. 1, # 6 p. 386 - 392 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-methoxy-4,5,2',3',4'-pentachlorobiphenyl |
| 1,1'-Biphenyl,2,3,3',4,4'-pentachloro-5'-methoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene have? |
| A: English synonyms of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene: 3-methoxy-4,5,2',3',4'-pentachlorobiphenyl, 1,1'-Biphenyl,2,3,3',4,4'-pentachloro-5'-methoxy. |
| Q: What is the CAS number of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: CAS number of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is 60082-87-3. |
| Q: What is the SMILES notation of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: SMILES notation of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is COc1cc(-c2ccc(Cl)c(Cl)c2Cl)cc(Cl)c1Cl. |
| Q: What is the InChIKey of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: InChIKey of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is ZBZQCPOTSOEMGU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60082-87-3? |
| A: Chinese name of 60082-87-3 is 60082-87-3. |
| Q: What is the English name of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: The English name of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene. |
| Q: What is the molecular weight of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: Molecular weight of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is 356.45900. |
| Q: What is the molecular formula of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: Molecular formula of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is C13H7Cl5O. |
| Q: What is the polar surface area (PSA) of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: Polar surface area (PSA) of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is 9.23000. |
| Q: What is the LogP of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene? |
| A: LogP of 1,2,3-trichloro-4-(3,4-dichloro-5-methoxyphenyl)benzene is 6.62920. |